CAS 174636-32-9 appears in our catalog under these names: Talnetant, >95% (HPLC), Talnetant/ 98%, Talnetant, Talnetant, 99.38%, 3-Hydroxy-2-phenyl-N-[(1S)-1-phenylpropyl]-4-quinolinecarboxamide, 95%, 95%. Offered by: TRC, TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 10g, 1g, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg.
3-hydroxy-2-phenyl-N-[(1S)-1-phenylpropyl]quinoline-4-carboxamide (CAS 174636-32-9) is a chemical compound with the molecular formula C25H22N2O2 and a molecular weight of 382.5 g/mol. IUPAC name: 3-hydroxy-2-phenyl-N-[(1S)-1-phenylpropyl]quinoline-4-carboxamide. InChIKey: BIAVGWDGIJKWRM-FQEVSTJZSA-N.
| Molecular formula | C25H22N2O2 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | 3-hydroxy-2-phenyl-N-[(1S)-1-phenylpropyl]quinoline-4-carboxamide |
| InChIKey | BIAVGWDGIJKWRM-FQEVSTJZSA-N |
| SMILES | CC[C@@H](C1=CC=CC=C1)NC(=O)C2=C(C(=NC3=CC=CC=C32)C4=CC=CC=C4)O |
Computed by PubChem (NCBI)