CAS 525581-65-1 is the registry number for (2-oxo-4-phenyl-6-(phenylamino)cyclohex-1-enyl)-N-benzamide. Offered by: Biosynth. Available pack sizes: 250mg.
2-hydroxy-N,4-diphenyl-6-phenyliminocyclohexene-1-carboxamide (CAS 525581-65-1) is a chemical compound with the molecular formula C25H22N2O2 and a molecular weight of 382.5 g/mol. IUPAC name: 2-hydroxy-N,4-diphenyl-6-phenyliminocyclohexene-1-carboxamide. InChIKey: HKJVUYOYXNCOBZ-UHFFFAOYSA-N.
| Molecular formula | C25H22N2O2 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | 2-hydroxy-N,4-diphenyl-6-phenyliminocyclohexene-1-carboxamide |
| InChIKey | HKJVUYOYXNCOBZ-UHFFFAOYSA-N |
| SMILES | C1C(CC(=NC2=CC=CC=C2)C(=C1O)C(=O)NC3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)