CAS 53525-60-3 appears in our catalog under these names: Ethyl 1-trityl-1H-imidazole-4-carboxylate, 97%, Ethyl 1–trityl–1H–imidazole–4–carboxylate. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 5g.
Ethyl 1-tritylimidazole-4-carboxylate (CAS 53525-60-3) is a chemical compound with the molecular formula C25H22N2O2 and a molecular weight of 382.5 g/mol. IUPAC name: ethyl 1-tritylimidazole-4-carboxylate. InChIKey: KXDKACKOPKUCBU-UHFFFAOYSA-N.
| Molecular formula | C25H22N2O2 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | ethyl 1-tritylimidazole-4-carboxylate |
| InChIKey | KXDKACKOPKUCBU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN(C=N1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)