CAS 2139356-35-5 appears in our catalog under these names: AMPD2 inhibitor 1, AMPD2 inhibitor 1, 98%, AMPD2 inhibitor 1, AMPD2 inhibitor 1, 99.52%. Offered by: GLPBio, AmBeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 100mg, 1mg, 10mg, 10mM (in 1ml dmso), 2mg, 25mg, 100 mg.
6-[4-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]pyridine-3-carboxylic acid (CAS 2139356-35-5) is a chemical compound with the molecular formula C25H22N2O2 and a molecular weight of 382.5 g/mol. IUPAC name: 6-[4-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]pyridine-3-carboxylic acid. InChIKey: YZNXMOIDDMETFM-QGZVFWFLSA-N.
| Molecular formula | C25H22N2O2 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | 6-[4-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]pyridine-3-carboxylic acid |
| InChIKey | YZNXMOIDDMETFM-QGZVFWFLSA-N |
| SMILES | C[C@H](C1=CC=CC2=CC=CC=C21)NCC3=CC=C(C=C3)C4=NC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)