CAS 17467-27-5 appears in our catalog under these names: 3-Benzyl-1,2,4-thiadiazol-5-amine, 3-Benzyl-1,2,4-thiadiazol-5-amine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 10g.
3-benzyl-1,2,4-thiadiazol-5-amine (CAS 17467-27-5) is a chemical compound with the molecular formula C9H9N3S and a molecular weight of 191.26 g/mol. IUPAC name: 3-benzyl-1,2,4-thiadiazol-5-amine. InChIKey: BDPJUFWVJYJIEY-UHFFFAOYSA-N.
| Molecular formula | C9H9N3S |
|---|---|
| Molecular weight | 191.26 g/mol |
| IUPAC name | 3-benzyl-1,2,4-thiadiazol-5-amine |
| InChIKey | BDPJUFWVJYJIEY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NSC(=N2)N |
Computed by PubChem (NCBI)