CAS 174671-92-2 appears in our catalog under these names: 5-Methoxy-1,3-dihydro-2,1-benzoxaborol-1-ol, 5-Methoxy-1,3-dihydro-2,1-benzoxaborol-1-ol 95%, 5-Methoxy-1,3-dihydro-2,1-benzoxaborol-1-ol, 95%, 95%, 5-Methoxybenzo[c][1,2]oxaborol-1(3H)-ol, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 50mg, 500mg, 2.5g, 10g.
1-hydroxy-5-methoxy-3H-2,1-benzoxaborole (CAS 174671-92-2) is a chemical compound with the molecular formula C8H9BO3 and a molecular weight of 163.97 g/mol. IUPAC name: 1-hydroxy-5-methoxy-3H-2,1-benzoxaborole. InChIKey: XBCBZHBKJDEYCI-UHFFFAOYSA-N.
| Molecular formula | C8H9BO3 |
|---|---|
| Molecular weight | 163.97 g/mol |
| IUPAC name | 1-hydroxy-5-methoxy-3H-2,1-benzoxaborole |
| InChIKey | XBCBZHBKJDEYCI-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=C(C=C2)OC)O |
Computed by PubChem (NCBI)