CAS 174681-81-3 appears in our catalog under these names: Methyl cis-3-methylpiperidine-2-carboxylate hydrochloride, 95%, cis-Methyl 3-methylpiperidine-2-carboxylate hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
Methyl (2S,3R)-3-methylpiperidine-2-carboxylate;hydrochloride (CAS 174681-81-3) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: methyl (2S,3R)-3-methylpiperidine-2-carboxylate;hydrochloride. InChIKey: ZVXKTMITCLKTLU-HHQFNNIRSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | methyl (2S,3R)-3-methylpiperidine-2-carboxylate;hydrochloride |
| InChIKey | ZVXKTMITCLKTLU-HHQFNNIRSA-N |
| SMILES | C[C@@H]1CCCN[C@@H]1C(=O)OC.Cl |
Computed by PubChem (NCBI)