CAS 174703-04-9 is the registry number for 1,2,3,3-Tetramethyl-3H-indol-1-ium-5-sulfonate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1,2,3,3-tetramethylindol-1-ium-5-sulfonate (CAS 174703-04-9) is a chemical compound with the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. IUPAC name: 1,2,3,3-tetramethylindol-1-ium-5-sulfonate. InChIKey: FTEUIDSOKJFKGE-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | 1,2,3,3-tetramethylindol-1-ium-5-sulfonate |
| InChIKey | FTEUIDSOKJFKGE-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C2=C(C1(C)C)C=C(C=C2)S(=O)(=O)[O-])C |
Computed by PubChem (NCBI)