Products 174727-79-8
CAS 174727-79-8 is the registry number for 1-((2,5-Dimethylphenyl)methyl)-2-methyl-1H-indole-3-carbaldehyde. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-[(2,5-dimethylphenyl)methyl]-2-methylindole-3-carbaldehyde (CAS 174727-79-8) is a chemical compound with the molecular formula C19H19NO and a molecular weight of 277.4 g/mol. IUPAC name: 1-[(2,5-dimethylphenyl)methyl]-2-methylindole-3-carbaldehyde. InChIKey: BKBLYESGHXPJPV-UHFFFAOYSA-N.
| Molecular formula | C19H19NO |
|---|---|
| Molecular weight | 277.4 g/mol |
| IUPAC name | 1-[(2,5-dimethylphenyl)methyl]-2-methylindole-3-carbaldehyde |
| InChIKey | BKBLYESGHXPJPV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)CN2C(=C(C3=CC=CC=C32)C=O)C |
Computed by PubChem (NCBI)