CAS 17488-64-1 appears in our catalog under these names: 3-Phenylcyclohex-2-en-1-ol, 3-Phenylcyclohex-2-en-1-ol, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.
3-phenylcyclohex-2-en-1-ol (CAS 17488-64-1) is a chemical compound with the molecular formula C12H14O and a molecular weight of 174.24 g/mol. IUPAC name: 3-phenylcyclohex-2-en-1-ol. InChIKey: ATRDVZTVELRNIP-UHFFFAOYSA-N.
| Molecular formula | C12H14O |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 3-phenylcyclohex-2-en-1-ol |
| InChIKey | ATRDVZTVELRNIP-UHFFFAOYSA-N |
| SMILES | C1CC(C=C(C1)C2=CC=CC=C2)O |
Computed by PubChem (NCBI)