CAS 175204-38-3 is the registry number for [3-(2,6-Dichlorophenyl)-5-methylisoxazol-4-yl]methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]methanol (CAS 175204-38-3) is a chemical compound with the molecular formula C11H9Cl2NO2 and a molecular weight of 258.10 g/mol. IUPAC name: [3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]methanol. InChIKey: YDHHKMQOVBJACX-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2NO2 |
|---|---|
| Molecular weight | 258.10 g/mol |
| IUPAC name | [3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]methanol |
| InChIKey | YDHHKMQOVBJACX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)CO |
Computed by PubChem (NCBI)