Products 72407-17-1
CAS 72407-17-1 appears in our catalog under these names: 2,4-Dichloro-6,7-dimethoxyquinoline, 95-<97%, 2,4-Dichloro-6,7-dimethoxyquinoline, ≥97-<99%, 2，4–Dichloro–6，7–dimethoxyquinoline, 2,4-dichloro-6,7-dimethoxyquinoline, 2,4-Dichloro-6,7-dimethoxyquinoline 98%. Offered by: Hoffman Fine Chemicals, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 2,5g, 5g, 10g, 25g, 100mg, 1g, 250mg, 500mg.
2,4-dichloro-6,7-dimethoxyquinoline (CAS 72407-17-1) is a chemical compound with the molecular formula C11H9Cl2NO2 and a molecular weight of 258.10 g/mol. IUPAC name: 2,4-dichloro-6,7-dimethoxyquinoline. InChIKey: WIGWEFGNYKPEKF-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2NO2 |
|---|---|
| Molecular weight | 258.10 g/mol |
| IUPAC name | 2,4-dichloro-6,7-dimethoxyquinoline |
| InChIKey | WIGWEFGNYKPEKF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=CC(=N2)Cl)Cl)OC |
Computed by PubChem (NCBI)
Synonyms:
2,4-dichloro-6,7-dimethoxy-quinoline