Products 2244453-83-4
CAS 2244453-83-4 is the registry number for Methyl 4,5-dichloro-6-methyl-1H-indole-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4,5-dichloro-6-methyl-1H-indole-2-carboxylate (CAS 2244453-83-4) is a chemical compound with the molecular formula C11H9Cl2NO2 and a molecular weight of 258.10 g/mol. IUPAC name: methyl 4,5-dichloro-6-methyl-1H-indole-2-carboxylate. InChIKey: BZTBICUHMFDASK-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2NO2 |
|---|---|
| Molecular weight | 258.10 g/mol |
| IUPAC name | methyl 4,5-dichloro-6-methyl-1H-indole-2-carboxylate |
| InChIKey | BZTBICUHMFDASK-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C(N2)C(=O)OC)C(=C1Cl)Cl |
Computed by PubChem (NCBI)