Products 220679-11-8
CAS 220679-11-8 is the registry number for Ethyl 6,7-Dichloro-1h-Indole-2-Carboxylate. Offered by: TRC. Available pack sizes: 500mg.
Ethyl 6,7-dichloro-1H-indole-2-carboxylate (CAS 220679-11-8) is a chemical compound with the molecular formula C11H9Cl2NO2 and a molecular weight of 258.10 g/mol. IUPAC name: ethyl 6,7-dichloro-1H-indole-2-carboxylate. InChIKey: FMVMKBJJIJVITG-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2NO2 |
|---|---|
| Molecular weight | 258.10 g/mol |
| IUPAC name | ethyl 6,7-dichloro-1H-indole-2-carboxylate |
| InChIKey | FMVMKBJJIJVITG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)