CAS 175224-99-4 appears in our catalog under these names: (S)–4–((tert–Butoxycarbonyl)amino)–4–phenylbutanoic acid, (4S)-4-[(tert-Butoxycarbonyl)amino]-4-phenylbutanoic acid, 95%, (S)-4-((tert-Butoxycarbonyl)amino)-4-phenylbutanoic acid, 97%, (S)-4-((tert-Butoxycarbonyl)amino)-4-phenylbutanoic acid, 97%, 97%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid (CAS 175224-99-4) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid. InChIKey: JBLPDLBZBHAMPD-LBPRGKRZSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid |
| InChIKey | JBLPDLBZBHAMPD-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)