Products 175225-48-6
CAS 175225-48-6 is the registry number for 2-(3-(Trifluoromethyl)phenyl)propanenitrile. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-[3-(trifluoromethyl)phenyl]propanenitrile (CAS 175225-48-6) is a chemical compound with the molecular formula C10H8F3N and a molecular weight of 199.17 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]propanenitrile. InChIKey: HEMKYZFNRRHYHH-UHFFFAOYSA-N.
| Molecular formula | C10H8F3N |
|---|---|
| Molecular weight | 199.17 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]propanenitrile |
| InChIKey | HEMKYZFNRRHYHH-UHFFFAOYSA-N |
| SMILES | CC(C#N)C1=CC(=CC=C1)C(F)(F)F |
Computed by PubChem (NCBI)