CAS 175277-90-4 appears in our catalog under these names: 4-(Isopropylamino)-3-nitrobenzotrifluoride, 97%, 4-iso-Propylamino-3-nitrobenzotrifluoride. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 5g, 1g.
2-nitro-N-propan-2-yl-4-(trifluoromethyl)aniline (CAS 175277-90-4) is a chemical compound with the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. IUPAC name: 2-nitro-N-propan-2-yl-4-(trifluoromethyl)aniline. InChIKey: KUROZHKSHLAXMC-UHFFFAOYSA-N.
| Molecular formula | C10H11F3N2O2 |
|---|---|
| Molecular weight | 248.20 g/mol |
| IUPAC name | 2-nitro-N-propan-2-yl-4-(trifluoromethyl)aniline |
| InChIKey | KUROZHKSHLAXMC-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=C(C=C(C=C1)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)