CAS 886215-55-0 appears in our catalog under these names: (S)-2-Amino-3-(6-trifluoromethyl-pyridin-3-yl)-propionic acid methyl ester, 95%, Methyl (S)-2-amino-3-(6-(trifluoromethyl)pyridin-3-yl)propanoate, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 250mg, 1g, on request.
Methyl (2S)-2-amino-3-[6-(trifluoromethyl)-3-pyridinyl]propanoate (CAS 886215-55-0) is a chemical compound with the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. IUPAC name: methyl (2S)-2-amino-3-[6-(trifluoromethyl)-3-pyridinyl]propanoate. InChIKey: OHIOGPXRWIHXSB-ZETCQYMHSA-N.
| Molecular formula | C10H11F3N2O2 |
|---|---|
| Molecular weight | 248.20 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-[6-(trifluoromethyl)-3-pyridinyl]propanoate |
| InChIKey | OHIOGPXRWIHXSB-ZETCQYMHSA-N |
| SMILES | COC(=O)[C@H](CC1=CN=C(C=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)