Products 1828137-91-2
CAS 1828137-91-2 is the registry number for 3-Amino-n-[2-(trifluoromethoxy)phenyl]propanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-amino-N-[2-(trifluoromethoxy)phenyl]propanamide (CAS 1828137-91-2) is a chemical compound with the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. IUPAC name: 3-amino-N-[2-(trifluoromethoxy)phenyl]propanamide. InChIKey: NAFYJOPOQUWLCX-UHFFFAOYSA-N.
| Molecular formula | C10H11F3N2O2 |
|---|---|
| Molecular weight | 248.20 g/mol |
| IUPAC name | 3-amino-N-[2-(trifluoromethoxy)phenyl]propanamide |
| InChIKey | NAFYJOPOQUWLCX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)CCN)OC(F)(F)F |
Computed by PubChem (NCBI)