Products 2197062-02-3
CAS 2197062-02-3 is the registry number for 1-(Cyclobutylmethyl)-5-(trifluoromethyl)-1h-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
1-(cyclobutylmethyl)-5-(trifluoromethyl)pyrazole-3-carboxylic acid (CAS 2197062-02-3) is a chemical compound with the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. IUPAC name: 1-(cyclobutylmethyl)-5-(trifluoromethyl)pyrazole-3-carboxylic acid. InChIKey: XZSZGBXPEZWQOB-UHFFFAOYSA-N.
| Molecular formula | C10H11F3N2O2 |
|---|---|
| Molecular weight | 248.20 g/mol |
| IUPAC name | 1-(cyclobutylmethyl)-5-(trifluoromethyl)pyrazole-3-carboxylic acid |
| InChIKey | XZSZGBXPEZWQOB-UHFFFAOYSA-N |
| SMILES | C1CC(C1)CN2C(=CC(=N2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)