Products 17542-05-1

CAS 17542-05-1 is the registry number for 2-Bromo-1-naphthoic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-bromonaphthalene-1-carboxylic acid (CAS 17542-05-1) is a chemical compound with the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. IUPAC name: 2-bromonaphthalene-1-carboxylic acid. InChIKey: VWVUFWQRRWSXAE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7BrO2
Molecular weight251.08 g/mol
IUPAC name2-bromonaphthalene-1-carboxylic acid
InChIKeyVWVUFWQRRWSXAE-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC(=C2C(=O)O)Br

Computed by PubChem (NCBI)