CAS 17542-05-1 is the registry number for 2-Bromo-1-naphthoic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-bromonaphthalene-1-carboxylic acid (CAS 17542-05-1) is a chemical compound with the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. IUPAC name: 2-bromonaphthalene-1-carboxylic acid. InChIKey: VWVUFWQRRWSXAE-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO2 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 2-bromonaphthalene-1-carboxylic acid |
| InChIKey | VWVUFWQRRWSXAE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C(=O)O)Br |
Computed by PubChem (NCBI)