Products 175471-65-5
CAS 175471-65-5 is the registry number for 2’-O-Methylisocytidine. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-amino-1-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrimidin-4-one (CAS 175471-65-5) is a chemical compound with the molecular formula C10H15N3O5 and a molecular weight of 257.24 g/mol. IUPAC name: 2-amino-1-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrimidin-4-one. InChIKey: YNICOGPIWXQHOX-ZOQUXTDFSA-N.
| Molecular formula | C10H15N3O5 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 2-amino-1-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]pyrimidin-4-one |
| InChIKey | YNICOGPIWXQHOX-ZOQUXTDFSA-N |
| SMILES | CO[C@@H]1[C@@H]([C@H](O[C@H]1N2C=CC(=O)N=C2N)CO)O |
Computed by PubChem (NCBI)