Products 175532-13-5
CAS 175532-13-5 appears in our catalog under these names: 2-(3-Chlorophenyl)-N'-hydroxyethenimidamide, 96%, 2-(3-Chlorophenyl)-N'-hydroxyethenimidamide, 95+%, 2-(3-Chlorophenyl)-N'-hydroxyethenimidamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 25g, 100g, 5g, 1g, 10g.
2-(3-chlorophenyl)-N'-hydroxyethanimidamide (CAS 175532-13-5) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 2-(3-chlorophenyl)-N'-hydroxyethanimidamide. InChIKey: JUTJREHZYDXQBH-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-N'-hydroxyethanimidamide |
| InChIKey | JUTJREHZYDXQBH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C/C(=N/O)/N |
Computed by PubChem (NCBI)