CAS 925252-77-3 appears in our catalog under these names: 2–(3–Chlorophenyl)–N–hydroxyacetimidamide, 2-(3-Chlorophenyl)-n'-hydroxyethanimidamide, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
2-(3-chlorophenyl)-N'-hydroxyethanimidamide (CAS 925252-77-3) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 2-(3-chlorophenyl)-N'-hydroxyethanimidamide. InChIKey: JUTJREHZYDXQBH-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-N'-hydroxyethanimidamide |
| InChIKey | JUTJREHZYDXQBH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C/C(=N/O)/N |
Computed by PubChem (NCBI)