CAS 1757-29-5 appears in our catalog under these names: Dimethyl 1H-pyrrole-2,5-dicarboxylate, 97%, 2,5-Dimethyl 1H-pyrrole-2,5-dicarboxylate, Dimethyl 1H-pyrrole-2,5-dicarboxylate, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 0,5g, 100mg, 250mg, 1g.
Dimethyl 1H-pyrrole-2,5-dicarboxylate (CAS 1757-29-5) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: dimethyl 1H-pyrrole-2,5-dicarboxylate. InChIKey: PMRHDIDDAMSGAA-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | dimethyl 1H-pyrrole-2,5-dicarboxylate |
| InChIKey | PMRHDIDDAMSGAA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(N1)C(=O)OC |
Computed by PubChem (NCBI)