CAS 17595-86-7 appears in our catalog under these names: methyl 4-(2-thienyl)benzenecarboxylate, Methyl 4-(thiophen-2-yl)benzoate. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
Methyl 4-thiophen-2-ylbenzoate (CAS 17595-86-7) is a chemical compound with the molecular formula C12H10O2S and a molecular weight of 218.27 g/mol. IUPAC name: methyl 4-thiophen-2-ylbenzoate. InChIKey: KQKUJLJBJZNZIZ-UHFFFAOYSA-N.
| Molecular formula | C12H10O2S |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | methyl 4-thiophen-2-ylbenzoate |
| InChIKey | KQKUJLJBJZNZIZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC=CS2 |
Computed by PubChem (NCBI)