CAS 176200-91-2 appears in our catalog under these names: 2-(2-Chloroethyl)-5-fluoroisoindoline-1,3-dione, 95%, 2-(2-Chloro-ethyl)-5-fluoro-isoindole-1,3-dione, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(2-chloroethyl)-5-fluoroisoindole-1,3-dione (CAS 176200-91-2) is a chemical compound with the molecular formula C10H7ClFNO2 and a molecular weight of 227.62 g/mol. IUPAC name: 2-(2-chloroethyl)-5-fluoroisoindole-1,3-dione. InChIKey: KYATUXRRFOJLJB-UHFFFAOYSA-N.
| Molecular formula | C10H7ClFNO2 |
|---|---|
| Molecular weight | 227.62 g/mol |
| IUPAC name | 2-(2-chloroethyl)-5-fluoroisoindole-1,3-dione |
| InChIKey | KYATUXRRFOJLJB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=O)N(C2=O)CCCl |
Computed by PubChem (NCBI)