CAS 2132418-12-1 appears in our catalog under these names: Methyl 4-chloro-5-fluoro-1H-indole-2-carboxylate, 98%, Methyl 4-chloro-5-fluoro-1H-indole-2-carboxylate 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 250mg, 1g, 5g.
Methyl 4-chloro-5-fluoro-1H-indole-2-carboxylate (CAS 2132418-12-1) is a chemical compound with the molecular formula C10H7ClFNO2 and a molecular weight of 227.62 g/mol. IUPAC name: methyl 4-chloro-5-fluoro-1H-indole-2-carboxylate. InChIKey: REXSHWFACLHVDH-UHFFFAOYSA-N.
| Molecular formula | C10H7ClFNO2 |
|---|---|
| Molecular weight | 227.62 g/mol |
| IUPAC name | methyl 4-chloro-5-fluoro-1H-indole-2-carboxylate |
| InChIKey | REXSHWFACLHVDH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(N1)C=CC(=C2Cl)F |
Computed by PubChem (NCBI)