CAS 1795362-29-6 appears in our catalog under these names: 2-Chloro-3-(1,3-dioxolan-2-yl)-6-fluorobenzonitrile, 95%, 2-Chloro-3-(1,3-dioxolan-2-yl)-6-fluorobenzonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-chloro-3-(1,3-dioxolan-2-yl)-6-fluorobenzonitrile (CAS 1795362-29-6) is a chemical compound with the molecular formula C10H7ClFNO2 and a molecular weight of 227.62 g/mol. IUPAC name: 2-chloro-3-(1,3-dioxolan-2-yl)-6-fluorobenzonitrile. InChIKey: QSLZDARSXGFKIV-UHFFFAOYSA-N.
| Molecular formula | C10H7ClFNO2 |
|---|---|
| Molecular weight | 227.62 g/mol |
| IUPAC name | 2-chloro-3-(1,3-dioxolan-2-yl)-6-fluorobenzonitrile |
| InChIKey | QSLZDARSXGFKIV-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C(=C(C=C2)F)C#N)Cl |
Computed by PubChem (NCBI)