CAS 17626-51-6 appears in our catalog under these names: 1,4-Dioxoquinoxaline-2-carboxaldehyde, 95%, 1,4-Dioxoquinoxaline-2-carboxaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-oxido-4-oxoquinoxalin-4-ium-2-carbaldehyde (CAS 17626-51-6) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 1-oxido-4-oxoquinoxalin-4-ium-2-carbaldehyde. InChIKey: JZJFIUXMPBVEFS-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 1-oxido-4-oxoquinoxalin-4-ium-2-carbaldehyde |
| InChIKey | JZJFIUXMPBVEFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C(=C[N+]2=O)C=O)[O-] |
Computed by PubChem (NCBI)