Products 176530-47-5

CAS 176530-47-5 is the registry number for 4-Chloro-2-(methylthio)thieno[3,2-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

4-chloro-2-methylsulfanylthieno[3,2-d]pyrimidine (CAS 176530-47-5) is a chemical compound with the molecular formula C7H5ClN2S2 and a molecular weight of 216.7 g/mol. IUPAC name: 4-chloro-2-methylsulfanylthieno[3,2-d]pyrimidine. InChIKey: YKVAWSVTEWXJGJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5ClN2S2
Molecular weight216.7 g/mol
IUPAC name4-chloro-2-methylsulfanylthieno[3,2-d]pyrimidine
InChIKeyYKVAWSVTEWXJGJ-UHFFFAOYSA-N
SMILESCSC1=NC2=C(C(=N1)Cl)SC=C2

Computed by PubChem (NCBI)