CAS 598298-10-3 appears in our catalog under these names: 4-Chloro-2-(methylthio)thieno[2,3-d]pyrimidine, 95%, 4-Chloro-2-(methylthio)thieno[2,3-d]pyrimidine 95%, 4-Chloro-2-(methylthio)thieno[2,3-d]pyrimidine, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-chloro-2-methylsulfanylthieno[2,3-d]pyrimidine (CAS 598298-10-3) is a chemical compound with the molecular formula C7H5ClN2S2 and a molecular weight of 216.7 g/mol. IUPAC name: 4-chloro-2-methylsulfanylthieno[2,3-d]pyrimidine. InChIKey: MPSIJWLMMVUKGB-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2S2 |
|---|---|
| Molecular weight | 216.7 g/mol |
| IUPAC name | 4-chloro-2-methylsulfanylthieno[2,3-d]pyrimidine |
| InChIKey | MPSIJWLMMVUKGB-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(C=CS2)C(=N1)Cl |
Computed by PubChem (NCBI)