Products 1338218-71-5
CAS 1338218-71-5 appears in our catalog under these names: 5-Chloro-3-[(thien-2-yl)methyl]-1,2,4-thiadiazole, 95%, 5-Chloro-3-((thien-2-yl)methyl)-1,2,4-thiadiazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g, 100mg.
5-chloro-3-(thiophen-2-ylmethyl)-1,2,4-thiadiazole (CAS 1338218-71-5) is a chemical compound with the molecular formula C7H5ClN2S2 and a molecular weight of 216.7 g/mol. IUPAC name: 5-chloro-3-(thiophen-2-ylmethyl)-1,2,4-thiadiazole. InChIKey: VHOCLEAGOMBKDR-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2S2 |
|---|---|
| Molecular weight | 216.7 g/mol |
| IUPAC name | 5-chloro-3-(thiophen-2-ylmethyl)-1,2,4-thiadiazole |
| InChIKey | VHOCLEAGOMBKDR-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)CC2=NSC(=N2)Cl |
Computed by PubChem (NCBI)