CAS 1801345-63-0 appears in our catalog under these names: 5-Chloro-2-(methylthio)thiazolo(4,5-b)pyridine, 95%, 5-chloro-2-methylsulfanyl-thiazolo[4,5-b]pyridine, 97%, 97%, 5-chloro-2-methylsulfanyl-thiazolo[4,5-b]pyridine, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
5-chloro-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine (CAS 1801345-63-0) is a chemical compound with the molecular formula C7H5ClN2S2 and a molecular weight of 216.7 g/mol. IUPAC name: 5-chloro-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine. InChIKey: UMADREYFZMNMHV-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2S2 |
|---|---|
| Molecular weight | 216.7 g/mol |
| IUPAC name | 5-chloro-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine |
| InChIKey | UMADREYFZMNMHV-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(S1)C=CC(=N2)Cl |
Computed by PubChem (NCBI)