CAS 17676-62-9 is the registry number for N1-Methyl ara-uridine. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylpyrimidine-2,4-dione (CAS 17676-62-9) is a chemical compound with the molecular formula C10H14N2O6 and a molecular weight of 258.23 g/mol. IUPAC name: 1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylpyrimidine-2,4-dione. InChIKey: UTQUILVPBZEHTK-BUJSFMDZSA-N.
| Molecular formula | C10H14N2O6 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylpyrimidine-2,4-dione |
| InChIKey | UTQUILVPBZEHTK-BUJSFMDZSA-N |
| SMILES | CN1C(=O)C=CN(C1=O)[C@H]2[C@H]([C@@H]([C@H](O2)CO)O)O |
Computed by PubChem (NCBI)