CAS 17687-64-8 is the registry number for 2-(3-Methyl-2-oxobutyl)isoindoline-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-methyl-2-oxobutyl)isoindole-1,3-dione (CAS 17687-64-8) is a chemical compound with the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. IUPAC name: 2-(3-methyl-2-oxobutyl)isoindole-1,3-dione. InChIKey: CKJAVTRPTYRMQT-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 2-(3-methyl-2-oxobutyl)isoindole-1,3-dione |
| InChIKey | CKJAVTRPTYRMQT-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)CN1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)