CAS 17720-22-8 is the registry number for 8-Phenyl-9H-purin-6-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
8-phenyl-7H-purin-6-amine (CAS 17720-22-8) is a chemical compound with the molecular formula C11H9N5 and a molecular weight of 211.22 g/mol. IUPAC name: 8-phenyl-7H-purin-6-amine. InChIKey: KFMQOHDPKOQCMU-UHFFFAOYSA-N.
| Molecular formula | C11H9N5 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 8-phenyl-7H-purin-6-amine |
| InChIKey | KFMQOHDPKOQCMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=NC=NC(=C3N2)N |
Computed by PubChem (NCBI)