Products 17722-52-0
CAS 17722-52-0 appears in our catalog under these names: 4-[(4-Chlorophenyl)amino]-4-oxobutanoic acid, 95%, N-(4-chlorophenyl)succinamic acid 97%, 4-[(4-CHLOROPHENYL)AMINO]-4-OXOBUTANOIC ACID, 98%, 98%, N-(4-CHLOROPHENYL)SUCCINAMIC ACID, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g.
4-(4-chloroanilino)-4-oxobutanoic acid (CAS 17722-52-0) is a chemical compound with the molecular formula C10H10ClNO3 and a molecular weight of 227.64 g/mol. IUPAC name: 4-(4-chloroanilino)-4-oxobutanoic acid. InChIKey: UPSNSRKMOHOEEO-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO3 |
|---|---|
| Molecular weight | 227.64 g/mol |
| IUPAC name | 4-(4-chloroanilino)-4-oxobutanoic acid |
| InChIKey | UPSNSRKMOHOEEO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)CCC(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
4'-chlorosuccinanilic acid, 4-[(4-chlorophenyl)amino]-4-oxobutanoic acid, 4-(4-chloroanilino)-4-oxobutanoic acid, 3-[(4-chlorophenyl)carbamoyl]propanoic acid, butanoic acid, 4-[(4-chlorophenyl)amino]-4-oxo-, 3-[N-(4-chlorophenyl)carbamoyl]propanoic acid, 4-((4-chlorophenyl)amino)-4-oxobutanoic acid, 4'-chlorosuc, Oprea1_348038, IFLab1_001224