CAS 177328-30-2 is the registry number for Ethyl 2-bromo-4-phenylthiazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl 2-bromo-4-phenyl-1,3-thiazole-5-carboxylate (CAS 177328-30-2) is a chemical compound with the molecular formula C12H10BrNO2S and a molecular weight of 312.18 g/mol. IUPAC name: ethyl 2-bromo-4-phenyl-1,3-thiazole-5-carboxylate. InChIKey: MYFOYOXMFDOSPN-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO2S |
|---|---|
| Molecular weight | 312.18 g/mol |
| IUPAC name | ethyl 2-bromo-4-phenyl-1,3-thiazole-5-carboxylate |
| InChIKey | MYFOYOXMFDOSPN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)Br)C2=CC=CC=C2 |
Computed by PubChem (NCBI)