Products 177328-30-2

CAS 177328-30-2 is the registry number for Ethyl 2-bromo-4-phenylthiazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 2-bromo-4-phenyl-1,3-thiazole-5-carboxylate (CAS 177328-30-2) is a chemical compound with the molecular formula C12H10BrNO2S and a molecular weight of 312.18 g/mol. IUPAC name: ethyl 2-bromo-4-phenyl-1,3-thiazole-5-carboxylate. InChIKey: MYFOYOXMFDOSPN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10BrNO2S
Molecular weight312.18 g/mol
IUPAC nameethyl 2-bromo-4-phenyl-1,3-thiazole-5-carboxylate
InChIKeyMYFOYOXMFDOSPN-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(N=C(S1)Br)C2=CC=CC=C2

Computed by PubChem (NCBI)