Products 1773496-63-1
CAS 1773496-63-1 appears in our catalog under these names: Cyprodinil-13C6, >95% (HPLC), Cyprodinil 13C6 (phenyl 13C6), Cyprodinil-13C6. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 10 mg, 1 mg, 5 mg.
N-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-4-cyclopropyl-6-methylpyrimidin-2-amine (CAS 1773496-63-1) is a chemical compound with the molecular formula C14H15N3 and a molecular weight of 231.25 g/mol. IUPAC name: N-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-4-cyclopropyl-6-methylpyrimidin-2-amine. InChIKey: HAORKNGNJCEJBX-FLBQOMCMSA-N.
| Molecular formula | C14H15N3 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | N-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-4-cyclopropyl-6-methylpyrimidin-2-amine |
| InChIKey | HAORKNGNJCEJBX-FLBQOMCMSA-N |
| SMILES | CC1=CC(=NC(=N1)N[13C]2=[13CH][13CH]=[13CH][13CH]=[13CH]2)C3CC3 |
Computed by PubChem (NCBI)