CAS 31575-15-2 is the registry number for 3-Ethyl-7-hydroxy-4,8-dimethyl-2h-chromen-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-ethyl-7-hydroxy-4,8-dimethylchromen-2-one (CAS 31575-15-2) is a chemical compound with the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. IUPAC name: 3-ethyl-7-hydroxy-4,8-dimethylchromen-2-one. InChIKey: GNXXGLPSRSIGOY-UHFFFAOYSA-N.
| Molecular formula | C13H14O3 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 3-ethyl-7-hydroxy-4,8-dimethylchromen-2-one |
| InChIKey | GNXXGLPSRSIGOY-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=C(C(=C(C=C2)O)C)OC1=O)C |
Computed by PubChem (NCBI)