Products 177409-39-1
CAS 177409-39-1 is the registry number for 1-Methyl-3-nitro-1h-pyrazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-methyl-3-nitropyrazole-5-carboxylic acid (CAS 177409-39-1) is a chemical compound with the molecular formula C5H5N3O4 and a molecular weight of 171.11 g/mol. IUPAC name: 1-methyl-3-nitropyrazole-5-carboxylic acid. InChIKey: ZTTJIDURGGLBHQ-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O4 |
|---|---|
| Molecular weight | 171.11 g/mol |
| IUPAC name | 1-methyl-3-nitropyrazole-5-carboxylic acid |
| InChIKey | ZTTJIDURGGLBHQ-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1-methyl-3-nitro-1H-pyrazole-5-carboxylic acid, 1-methyl-3-nitropyrazole-5-carboxylic acid, 2-methyl-5-nitropyrazole-3-carboxylic acid, 2-Methyl-5-nitro-pyrazole-3-carboxylic acid, 1H-Pyrazole-5-carboxylic acid, 1-methyl-3-nitro-, ZTTJIDURGGLBHQ-UHFFFAOYSA-N, 1-methyl-3-nitro-1H-pyrazole-5-carboxylicacid