CAS 177485-72-2 is the registry number for 5-(Chloromethyl)imidazo(1,2-a)pyridine hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-(chloromethyl)imidazo[1,2-a]pyridine;hydrochloride (CAS 177485-72-2) is a chemical compound with the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. IUPAC name: 5-(chloromethyl)imidazo[1,2-a]pyridine;hydrochloride. InChIKey: IXCKWFAIBSWOFR-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2 |
|---|---|
| Molecular weight | 203.07 g/mol |
| IUPAC name | 5-(chloromethyl)imidazo[1,2-a]pyridine;hydrochloride |
| InChIKey | IXCKWFAIBSWOFR-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CN2C(=C1)CCl.Cl |
Computed by PubChem (NCBI)