CAS 17765-88-7 is the registry number for 5,7-dimethylisatin, 3-thiosemicarbazone. Offered by: Biosynth. Available pack sizes: 250mg.
(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)iminothiourea (CAS 17765-88-7) is a chemical compound with the molecular formula C11H12N4OS and a molecular weight of 248.31 g/mol. IUPAC name: (2-hydroxy-5,7-dimethyl-1H-indol-3-yl)iminothiourea. InChIKey: HTDJZMISNHTPTM-UHFFFAOYSA-N.
| Molecular formula | C11H12N4OS |
|---|---|
| Molecular weight | 248.31 g/mol |
| IUPAC name | (2-hydroxy-5,7-dimethyl-1H-indol-3-yl)iminothiourea |
| InChIKey | HTDJZMISNHTPTM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=C(N2)O)N=NC(=S)N)C |
Computed by PubChem (NCBI)