CAS 847744-40-5 is the registry number for 2-(3-(3-Methylphenyl)-5-sulfanyl-4H-1,2,4-triazol-4-yl)acetamide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide (CAS 847744-40-5) is a chemical compound with the molecular formula C11H12N4OS and a molecular weight of 248.31 g/mol. IUPAC name: 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide. InChIKey: VULYZDXXSOOBAV-UHFFFAOYSA-N.
| Molecular formula | C11H12N4OS |
|---|---|
| Molecular weight | 248.31 g/mol |
| IUPAC name | 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetamide |
| InChIKey | VULYZDXXSOOBAV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NNC(=S)N2CC(=O)N |
Computed by PubChem (NCBI)