CAS 177948-40-2 is the registry number for (R)-1-(4-Fluorophenyl)-2-methoxyethanamine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(1R)-1-(4-fluorophenyl)-2-methoxyethanamine;hydrochloride (CAS 177948-40-2) is a chemical compound with the molecular formula C9H13ClFNO and a molecular weight of 205.66 g/mol. IUPAC name: (1R)-1-(4-fluorophenyl)-2-methoxyethanamine;hydrochloride. InChIKey: GVLYRDMYMGFBQS-FVGYRXGTSA-N.
| Molecular formula | C9H13ClFNO |
|---|---|
| Molecular weight | 205.66 g/mol |
| IUPAC name | (1R)-1-(4-fluorophenyl)-2-methoxyethanamine;hydrochloride |
| InChIKey | GVLYRDMYMGFBQS-FVGYRXGTSA-N |
| SMILES | COC[C@@H](C1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)