Products 177960-04-2

CAS 177960-04-2 is the registry number for 2-Methylalanine phenyl ester. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Phenyl 2-amino-2-methylpropanoate (CAS 177960-04-2) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: phenyl 2-amino-2-methylpropanoate. InChIKey: BTRBTFZELAQTJS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO2
Molecular weight179.22 g/mol
IUPAC namephenyl 2-amino-2-methylpropanoate
InChIKeyBTRBTFZELAQTJS-UHFFFAOYSA-N
SMILESCC(C)(C(=O)OC1=CC=CC=C1)N

Computed by PubChem (NCBI)