Products 1779842-32-8
CAS 1779842-32-8 appears in our catalog under these names: 8-Hydroxy-3,4-dihydro-2H-1,3-benzoxazin-2-one, 95%, 8-Hydroxy-3,4-dihydro-2H-1,3-benzoxazin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
8-hydroxy-3,4-dihydro-1,3-benzoxazin-2-one (CAS 1779842-32-8) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 8-hydroxy-3,4-dihydro-1,3-benzoxazin-2-one. InChIKey: HEDJCRMRVCKUSA-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 8-hydroxy-3,4-dihydro-1,3-benzoxazin-2-one |
| InChIKey | HEDJCRMRVCKUSA-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)O)OC(=O)N1 |
Computed by PubChem (NCBI)