Products 1779899-22-7
CAS 1779899-22-7 is the registry number for 7-bromothieno(2,3-b)pyrazine-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-bromothieno[2,3-b]pyrazine-6-carboxylic acid (CAS 1779899-22-7) is a chemical compound with the molecular formula C7H3BrN2O2S and a molecular weight of 259.08 g/mol. IUPAC name: 7-bromothieno[2,3-b]pyrazine-6-carboxylic acid. InChIKey: WGHGXDQAPFWFBE-UHFFFAOYSA-N.
| Molecular formula | C7H3BrN2O2S |
|---|---|
| Molecular weight | 259.08 g/mol |
| IUPAC name | 7-bromothieno[2,3-b]pyrazine-6-carboxylic acid |
| InChIKey | WGHGXDQAPFWFBE-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C(=C(S2)C(=O)O)Br |
Computed by PubChem (NCBI)