Products 1782251-89-1
CAS 1782251-89-1 is the registry number for 5-Bromoisothiazolo[5,4-b]pyridine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-[1,2]thiazolo[5,4-b]pyridine-3-carboxylic acid (CAS 1782251-89-1) is a chemical compound with the molecular formula C7H3BrN2O2S and a molecular weight of 259.08 g/mol. IUPAC name: 5-bromo-[1,2]thiazolo[5,4-b]pyridine-3-carboxylic acid. InChIKey: BYRTWYVOQKTWQL-UHFFFAOYSA-N.
| Molecular formula | C7H3BrN2O2S |
|---|---|
| Molecular weight | 259.08 g/mol |
| IUPAC name | 5-bromo-[1,2]thiazolo[5,4-b]pyridine-3-carboxylic acid |
| InChIKey | BYRTWYVOQKTWQL-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=NS2)C(=O)O)Br |
Computed by PubChem (NCBI)